Potassium Carbonate → 3,5-Dimethyl-6-phenanthridinamine

HRID 2176365Notes

Reaction equation

HRID 2176365 reaction equation
[C:1]([C:3]1[CH:8]=[CH:7][CH:6]=[CH:5][C:4]=1B1OC(C)(C)C(C)(C)O1)#[N:2].BrC1C=C(C)C=C(C)[C:20]=1[NH2:21].C(=O)([O-])[O-].[K+].[K+].[C:34]1([CH3:40])[CH:39]=[CH:38][CH:37]=[CH:36][CH:35]=1.CO>C1C=CC([P]([Pd]([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)[P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)=CC=1>[CH3:40][C:34]1[CH:39]=[CH:38][C:37]2[C:4]3[C:3]([CH:1]([NH2:2])[N:21]([CH3:20])[C:36]=2[CH:35]=1)=[CH:8][CH:7]=[CH:6][CH:5]=3

Participants

6

Reactant 4

HCID 11430Potassium CarbonateHCID 1705792-Bromo-4,6-dimethylanilineHCID 35702292-(2-Cyanophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolaneHCID 21867641Toluene methanol

Product 1

HCID 574535493,5-Dimethyl-6-phenanthridinamineYield 82%

Reagents, catalysts & solvents 1

HCID 178418397HCID 178418397, compoundCatalyst

Procedure

Added together 2-cyanophenylboronic acid pinacol ester (13.7 g, 60 mmol), 2-bromo-4,6-dimethylaniline (10.0 g, 50 mmol), tetrakis(triphenylphosphine)palladium(0) (2.3 g, 2.0 mmol) and potassium carbonate (18.6 g, 138.21 mol) to a 125 mL of a 95/5 mixture of toluene/methanol. The solvents were degassed and the reaction mixture heated to reflux for 48 hours. After cooling, the reaction mixture was vacuum filtered and the organics evaporated and crude product was purified using silica gel column chromatography treated with triethylamine and 1:9 ethyl acetate and methylene chloride mixture as the eluants. The pure product was collected and concentrated to give 3,5-dimethyl-6-phenanthridinamine (9.1 g, 82% Yield).

Workup

  1. customThe solvents were degassed
  2. temperaturethe reaction mixture heated
  3. temperatureto reflux for 48 hours
  4. temperatureAfter cooling
  5. filtrationfiltered
  6. customthe organics evaporated
  7. customcrude product was purified
  8. additiontreated with triethylamine and 1:9 ethyl acetate and methylene chloride mixture as the eluants
  9. customThe pure product was collected
  10. concentrationconcentrated

Sources & evidence

ORD record
ord-91a45731105d44d9adf07c6ae94dd124
Source dataset
uspto-grants-2015_06
Patent number
US09065063B2

Reaction notes

Loading…