1-(7-Bromo-3-nitroquinolin-4-ylamino)-2-methylpropan-2-ol → 1-(3-Amino-7-bromoquinolin-4-ylamino)-2-methylpropan-2-ol

HRID 244826노트

반응식

HRID 244826 반응식
[Br:1][C:2]1[CH:11]=[C:10]2[C:5]([C:6]([NH:15][CH2:16][C:17]([CH3:20])([OH:19])[CH3:18])=[C:7]([N+:12]([O-])=O)[CH:8]=[N:9]2)=[CH:4][CH:3]=1>[Pt].C(#N)C.C1(C)C=CC=CC=1>[NH2:12][C:7]1[CH:8]=[N:9][C:10]2[C:5]([C:6]=1[NH:15][CH2:16][C:17]([CH3:18])([OH:19])[CH3:20])=[CH:4][CH:3]=[C:2]([Br:1])[CH:11]=2

참가 물질

4

반응물 1

HCID 219844361-(7-Bromo-3-nitroquinolin-4-ylamino)-2-methylpropan-2-ol

생성물 1

HCID 219844571-(3-Amino-7-bromoquinolin-4-ylamino)-2-methylpropan-2-ol수율 92.9%

시약·촉매·용매 2

HCID 23939Platinum촉매HCID 21584213Acetonitrile toluene용매

실험 절차

A glass Parr vessel was charged with 5% platinum on carbon catalyst (5 g), 1-(7-bromo-3-nitroquinolin-4-ylamino)-2-methylpropan-2-ol (57 g, 0.17 mol), and a 1:1 solution of acetonitrile/toluene (1800 mL). The vessel was evacuated, charged with hydrogen gas (50 psi, 3.4×105 Pa), and shaken for 5 hours. The reaction mixture was then filtered through a 0.2 micron polytetrafluoroethylene (PTFE) membrane filter. The filtrate was concentrated to provide 49 g of 1-[(3-amino-7-bromoquinolin-4-yl)amino]-2-methylpropan-2-ol as a bright yellow-orange solid.

후처리

  1. customThe vessel was evacuated
  2. additioncharged with hydrogen gas (50 psi, 3.4×105 Pa)
  3. filtrationThe reaction mixture was then filtered through a 0.2 micron polytetrafluoroethylene (PTFE) membrane
  4. filtrationfilter
  5. concentrationThe filtrate was concentrated

출처 및 근거

ORD 기록
ord-d60cdab996354a8b859381f8f0bee68a
출처 데이터셋
uspto-grants-2014_02
특허 번호
US08658666B2

반응 노트

불러오는 중…