Ethanol → Ethyl 2-cyclohexylpropionate

HRID 728540Notes

Reaction equation

HRID 728540 reaction equation
[CH:1]1([CH:7]([CH3:11])[C:8]([O-:10])=[O:9])[CH2:6][CH2:5][CH2:4][CH2:3][CH2:2]1.[CH2:12](O)[CH3:13]>C1(C)C=CC(S(O)(=O)=O)=CC=1.C(Cl)(Cl)Cl>[CH:1]1([CH:7]([CH3:11])[C:8]([O:10][CH2:12][CH3:13])=[O:9])[CH2:6][CH2:5][CH2:4][CH2:3][CH2:2]1

Participants

5

Reactant 2

HCID 702EthanolHCID 220164732-Cyclo-hexylpropionate

Product 1

HCID 160641Ethyl 2-cyclohexylpropionateYield 96%

Reagents, catalysts & solvents 2

HCID 6101p-Toluenesulfonic acidCatalystHCID 6212ChloroformSolvent

Procedure

Into a 500 ml round bottom flask equipped with a Soxhlet extractor filled with molecular sieves, 50 g of 2-cyclo-hexylpropionate, 100 g of ethanol, 0.5 g of p-toluene sulfonic acid, and 200 ml of chloroform were charged. The mixture was reacted under refluxing for 40 hours. The reaction mixture was washed with water and distilled under reduced pressure to obtain 56.4 g of ethyl 2-cyclohexylpropionate (yield: 96%, purity: 99.4%). The compound obtained had a fruity (namely aldehyde C-16 and apple-like) odor.

Workup

  1. customInto a 500 ml round bottom flask equipped with a Soxhlet extractor
  2. additionwere charged
  3. customThe mixture was reacted
  4. temperatureunder refluxing for 40 hours
  5. washThe reaction mixture was washed with water
  6. distillationdistilled under reduced pressure

Sources & evidence

ORD record
ord-abc26ddb0e7c40968d2fa53c257c1ac0
Source dataset
uspto-grants-1991_09
Patent number
US05049544

Reaction notes

Loading…