Hydrochloric Acid → HCID 21283456, compound

HRID 979584Notes

Reaction equation

HRID 979584 reaction equation
[OH:1][C:2]1[C:3]([O:14][CH3:15])=[CH:4][C:5]2[CH:9]=[C:8](C(O)=O)[S:7][C:6]=2[CH:13]=1.Cl>[Cu].N1C2C(=CC=CC=2)C=CC=1>[OH:1][C:2]1[C:3]([O:14][CH3:15])=[CH:4][C:5]2[CH:9]=[CH:8][S:7][C:6]=2[CH:13]=1

Participants

5

Reactant 2

HCID 313Hydrochloric AcidHCID 212834786-Hydroxy-5-methoxybenzo[b]thiophene-2-carboxylic acid

Product 1

HCID 21283456HCID 21283456, compound

Reagents, catalysts & solvents 2

HCID 23978CopperCatalystHCID 7047QuinolineSolvent

Procedure

A mixture of the product from Step C (8 g), copper dust (2 g) and quinoline (40 mL) was heated under reflux for two hours. The hot reaction mixture was poured onto crushed ice (200 g), acidified with 6N hydrochloric acid and filtered. The filtrate was washed with saturated sodium chloride solution, dried (Na2SO4) and filtered and the solvent was evaporated in vacuo, leaving 5 g of waxy solid.

Workup

  1. temperaturewas heated
  2. temperatureunder reflux for two hours
  3. additionThe hot reaction mixture was poured
  4. filtrationfiltered
  5. washThe filtrate was washed with saturated sodium chloride solution
  6. dry with materialdried (Na2SO4)
  7. filtrationfiltered
  8. customthe solvent was evaporated in vacuo
  9. customleaving 5 g of waxy solid

Sources & evidence

ORD record
ord-0750d33dc94443628a419d9875f38132
Source dataset
uspto-grants-1987_05
Patent number
US04668697

Reaction notes

Loading…