Dichloromethane → 1-Methoxy-4-methyl-2-nitrobenzene

HRID 1032960

반응식

HRID 1032960 반응식
[N+:1]([C:4]1[C:9]([OH:10])=[CH:8][CH:7]=[C:6]([CH3:11])[CH:5]=1)([O-:3])=[O:2].[CH2:12](Cl)Cl.[OH-].[Na+].S(OC)(OC)(=O)=O>S([O-])(O)(=O)=O.C([N+](CCCC)(CCCC)CCCC)CCC.O>[CH3:11][C:6]1[CH:7]=[CH:8][C:9]([O:10][CH3:12])=[C:4]([N+:1]([O-:3])=[O:2])[CH:5]=1

참가 물질

7

반응물 4

HCID 6344DichloromethaneHCID 6497Dimethyl SulfateHCID 83914-Methyl-2-nitrophenolHCID 14798Sodium Hydroxide

생성물 1

HCID 670581-Methoxy-4-methyl-2-nitrobenzene

시약·촉매·용매 2

HCID 94433Tetrabutylammonium hydrogen sulfate촉매HCID 962Water용매

실험 절차

A reaction mixture of 2-nitro-p-cresol (23.58 g, 0.154 mmol), methylene chloride (200 ml), tetra-n-butylammonium hydrogensulfate (5.15 g, 15.2 mmol), 1N sodium hydroxide (170 ml) and dimethyl sulfate (16.0 ml, 0.169 mmol) was stirred at room temperature for 2 hours. The reaction mixture was poured into water and extracted with methylene chloride. The organic layer was washed with brine, dried over anhydrous magnesium sulfate and evaporated. The concentrate was immediately used for the next reaction.

후처리

  1. extractionextracted with methylene chloride
  2. washThe organic layer was washed with brine
  3. dry with materialdried over anhydrous magnesium sulfate
  4. customevaporated
  5. customThe concentrate was immediately used for the next reaction

출처 및 근거

ORD 기록
ord-094d3f7d7ae542c3b24245f12e026bc1
출처 데이터셋
uspto-grants-1994_05
특허 번호
US05308840

연결된 노트

불러오는 중…