Sodium Hydroxide → HCID 67264226, 화합물

HRID 1040604

반응식

HRID 1040604 반응식
[CH3:1][O:2][C:3]1[CH:13]=[CH:12][C:6]2[CH2:7][CH2:8][NH:9][CH2:10][CH2:11][C:5]=2[CH:4]=1.FC(F)(F)C([NH-])=O.N1C2C=CC=CC=2C=CC=C1.[N+:32]([O-:35])([O-:34])=[O:33].[K+].[OH-].[Na+]>C(#N)C.FC(F)(F)C(OC(=O)C(F)(F)F)=O>[CH3:1][O:2][C:3]1[C:13]([N+:32]([O-:34])=[O:33])=[CH:12][C:6]2[CH2:7][CH2:8][NH:9][CH2:10][CH2:11][C:5]=2[CH:4]=1.[CH3:1][O:2][C:3]1[CH:13]=[C:12]([N+:32]([O-:35])=[O:33])[C:6]2[CH2:7][CH2:8][NH:9][CH2:10][CH2:11][C:5]=2[CH:4]=1

참가 물질

9

반응물 5

HCID 14798Sodium HydroxideHCID 24434Potassium NitrateHCID 138533487-Methoxy-2,3,4,5-tetrahydro-1h-3-benzazepineHCID 155596581H-1-BenzazepineHCID 178514236HCID 178514236, 화합물

생성물 2

HCID 67264226HCID 67264226, 화합물HCID 672643517-Methoxy-8-nitro-2,3,4,5-tetrahydro-1H-benzo[d]azepine

시약·촉매·용매 2

HCID 6342Acetonitrile용매HCID 9845Trifluoroacetic anhydride용매

반응 조건

온도
0 °C

실험 절차

7-Methoxy-2,3,4,5-tetrahydro-1H-benzo[d]azepine (750 mg/4.2 mmol) was dissolved in a mixture of dry acetonitrile (3 mL) and trifluoroacetic anhydride (3 mL) and cooled to 0° C. (ice bath). The trifluoroacetyl amide of the benzazepine forms immediately (observed by HPLC). Potassium nitrate (450 mg/4.2 mmol) was added in one portion and the mixture allowed to warm to room temperature. After one hour the reaction was complete (HPLC); 33% sodium hydroxide (1 mL) was added via pipette (exotherm) and the mixture stirred for an additional two hours (to hydrolyze the TFA amide). The resulting mixture was partitioned between water (20 mL) and methylene chloride (20 mL). The aqueous layer was extracted with an additional portion of methylene chloride (20 mL) and the combined organics were dried over magnesium sulfate, filtered and concentrated to afford a 1.7:1 ratio of 7-Methoxy-8-nitro-2,3,4,5-tetrahydro-1H-benzo[d]azepine and 7-Methoxy-9-nitro-2,3,4,5-tetrahydro-1H-benzo[d]azepine as a yellow oil (770 mg/82%). The material was used without further purification. 1H NMR (400 MHz, CDCl3) major isomer: δ 7.66 (s, 1H), 6.82 (s 1H); minor isomer: 7.14 (d, J=8.3 Hz, 1H), 6.76 (d, J=8.3 Hz, 1H).

후처리

  1. temperatureto warm to room temperature
  2. customThe resulting mixture was partitioned between water (20 mL) and methylene chloride (20 mL)
  3. extractionThe aqueous layer was extracted with an additional portion of methylene chloride (20 mL)
  4. dry with materialthe combined organics were dried over magnesium sulfate
  5. filtrationfiltered
  6. concentrationconcentrated

출처 및 근거

ORD 기록
ord-a5235457eceb45c7b9d4ab36eea368bf
출처 데이터셋
uspto-grants-2013_10
특허 번호
US08552186B2

연결된 노트

불러오는 중…