Potassium Iodide → 1-(Bromomethyl)-3-chloro-5-methylbenzene

HRID 1194722

반응식

HRID 1194722 반응식
[Cl:1][C:2]1[CH:3]=[C:4]([CH3:9])[CH:5]=[C:6]([CH3:8])[CH:7]=1.[Br:10]N1C(=O)CCC1=O.[I-].[K+]>C1C=CC=CC=1.C(OOC(=O)C1C=CC=CC=1)(=O)C1C=CC=CC=1>[Cl:1][C:2]1[CH:7]=[C:6]([CH:5]=[C:4]([CH3:9])[CH:3]=1)[CH2:8][Br:10]

참가 물질

6

반응물 3

HCID 4875Potassium IodideHCID 328873,5-DimethylchlorobenzeneHCID 67184N-bromobutanimide

생성물 1

HCID 123755491-(Bromomethyl)-3-chloro-5-methylbenzene수율 109.1%

시약·촉매·용매 2

HCID 7187Benzoyl Peroxide촉매HCID 241Benzene용매

실험 절차

A solution of 5-chloro-m-xylene (59.3 g) and dibenzoyl peroxide (5.0 g) in 1.13 L of benzene was heated at reflux. N-Bromosuccinimide (82.2 g) was added in portions over 15 minutes. Heating was continued for an additional 20 minutes until a negative potassium iodide reaction was observed. The reaction mixture was cooled, evaporated and then titurated with hexane (500 ml). The precipitated succinimide was removed by filtration and washed with additional hexane. Concentration afforded 101 g of crude 3-chloro-5-methylbenzyl bromide.

후처리

  1. temperatureat reflux
  2. temperatureHeating
  3. temperatureThe reaction mixture was cooled
  4. customevaporated
  5. customThe precipitated succinimide was removed by filtration
  6. washwashed with additional hexane
  7. concentrationConcentration

출처 및 근거

ORD 기록
ord-1cf85b3a1f3445a68f29f1be99623e2a
출처 데이터셋
uspto-grants-1989_03
특허 번호
US04816469

연결된 노트

불러오는 중…