Oxalyl chloride → HCID 57732770, 화합물

HRID 1806485노트

반응식

HRID 1806485 반응식
[O:1]1[CH2:5][CH2:4][CH:3]([C:6]([OH:8])=O)[CH2:2]1.C(Cl)(=O)C(Cl)=O.[NH2:15][CH2:16][C:17]1[CH:18]=[C:19]([C:23]2[CH:24]=[C:25]3[C:29](=[C:30]([C:32]([NH2:34])=[O:33])[CH:31]=2)[NH:28][CH:27]=[C:26]3[CH:35]2[CH2:40][CH2:39][N:38]([S:41]([CH2:44][CH3:45])(=[O:43])=[O:42])[CH2:37][CH2:36]2)[CH:20]=[CH:21][CH:22]=1.CCN(C(C)C)C(C)C>C(Cl)Cl.N1C=CC=CC=1.CN(C=O)C>[CH2:44]([S:41]([N:38]1[CH2:39][CH2:40][CH:35]([C:26]2[C:25]3[C:29](=[C:30]([C:32]([NH2:34])=[O:33])[CH:31]=[C:23]([C:19]4[CH:20]=[CH:21][CH:22]=[C:17]([CH2:16][NH:15][C:6]([CH:3]5[CH2:4][CH2:5][O:1][CH2:2]5)=[O:8])[CH:18]=4)[CH:24]=3)[NH:28][CH:27]=2)[CH2:36][CH2:37]1)(=[O:43])=[O:42])[CH3:45]

참가 물질

8

반응물 4

HCID 65578Oxalyl chlorideHCID 81531DiisopropylethylamineHCID 4661317(R)-Tetrahydro-3-furoic acidHCID 16038109HCID 16038109, 화합물

생성물 1

HCID 57732770HCID 57732770, 화합물수율 10.2%

시약·촉매·용매 3

HCID 1049Pyridine촉매HCID 6228Dimethylformamide용매HCID 6344Dichloromethane용매

실험 절차

To a solution of tetrahydro-3-furancarboxylic acid (17 mg, 0.144 mmol) in DCM (2.0 mL) was added pyridine (3 drops) and oxalyl chloride (18 mg, 0.144 mmol). Reaction mixture was stirred overnight at room temperature. To the mixture was then added 5-[3-(aminomethyl)phenyl]-3-[1-(ethylsulfonyl)-4-piperidinyl]-1H-indole-7-carboxamide (40 mg, 0.096 mmol) in DMF (1.0 mL) and DIEA (33 μL, 0.192 mmol). Reaction mixture was stirred at room temperature overnight. Reaction mixture was concentrated under nitrogen and purified by Gilson Preparatory HPLC to give 5.3 mg the title compound (10%).

후처리

  1. customReaction mixture
  2. customReaction mixture
  3. stirringwas stirred at room temperature overnight
  4. customReaction mixture
  5. concentrationwas concentrated under nitrogen
  6. custompurified by Gilson Preparatory HPLC

출처 및 근거

ORD 기록
ord-fcd342de0dea4c0e97c422e62a3e0ef2
출처 데이터셋
uspto-grants-2013_01
특허 번호
US08354406B2

반응 노트

불러오는 중…