Hydrochloric Acid → 17-Hydroxyprogesterone

HRID 1979672

반응식

HRID 1979672 반응식
[C:1]([C@:3]1([OH:23])[CH2:8][CH2:7][C@H:6]2[C@H:9]3[C@H:19]([CH2:20][CH2:21][C@:4]12[CH3:5])[C@:17]1([CH3:18])[C:12](=[CH:13][C:14](=[O:22])[CH2:15][CH2:16]1)[CH2:11][CH2:10]3)#[CH:2].Cl.C[OH:26]>C([O-])(=O)C.[Hg+2].C([O-])(=O)C>[OH:23][C@:3]1([C@:4]2([CH3:5])[C@H:6]([C@H:9]3[C@H:19]([CH2:20][CH2:21]2)[C@:17]2([CH3:18])[C:12](=[CH:13][C:14](=[O:22])[CH2:15][CH2:16]2)[CH2:11][CH2:10]3)[CH2:7][CH2:8]1)[C:1](=[O:26])[CH3:2]

참가 물질

5

반응물 3

HCID 313Hydrochloric AcidHCID 887MethanolHCID 5284557Ethisterone

생성물 1

HCID 623817-Hydroxyprogesterone

시약·촉매·용매 1

HCID 15337Mercuric acetate촉매

실험 절차

Starting from 3.12 g (0.01 mole) of 17α-ethynyl-17β-hydroxy-androst-4-en-3-one one proceeds as described in Example 9 but after the reaction with mercury(II)-acetate the mixture is not poured onto water but the mixture of 24 ml of concentrated hydrochloric acid and 40 ml of methyl alcohol is added thereto. The reaction mixture is stirred at a temperature of 48° to 50° C. for 8 hours, then it is poured onto water. The separated product is filtered, washed with water and dried. Thus 2.70 g of 17α-hydroxy-pregn-4-ene-3,20-dione are obtained (82.1% of the theoretical yield). The crude product is crystallized from methyl alcohol. Melting point: 212°to 217° C.; [α]D20 =+89° (CHC13, c=1%).

후처리

  1. additionis not poured onto water
  2. additionis added
  3. additionit is poured onto water
  4. filtrationThe separated product is filtered
  5. washwashed with water
  6. customdried

출처 및 근거

ORD 기록
ord-1cbace7a4e5142eb9f876410a4d21ef4
출처 데이터셋
uspto-grants-1984_11
특허 번호
US04482494

연결된 노트

불러오는 중…