N-bromobutanimide → HCID 57656172, 화합물

HRID 2041452노트

반응식

HRID 2041452 반응식
[CH3:1][C:2]([CH3:14])([CH3:13])[CH2:3][C:4]([C:6]1[CH:11]=[CH:10][C:9]([CH3:12])=[CH:8][CH:7]=1)=[O:5].C1C(=O)N([Br:22])C(=O)C1>C(Cl)(Cl)(Cl)Cl.CC(N=NC(C#N)(C)C)(C#N)C>[CH3:1][C:2]([CH3:14])([CH3:13])[CH2:3][C:4]([C:6]1[CH:7]=[CH:8][C:9]([CH2:12][Br:22])=[CH:10][CH:11]=1)=[O:5]

참가 물질

5

반응물 2

HCID 67184N-bromobutanimideHCID 178606563,3-Dimethyl-1-(4-methylphenyl)butan-1-one

생성물 1

HCID 57656172HCID 57656172, 화합물수율 90%

시약·촉매·용매 2

HCID 6547Azobisisobutyronitrile촉매HCID 5943Carbon Tetrachloride용매

실험 절차

Heat a mixture of 3,3,4′-trimethylbutyrophenone (2 g, 10.52 mmol), NBS (2.061 g, 11.57 mmol), and AIBN (43 mg, 0.263 mmol) in carbon tetrachloride (60 mL) for 14 h at reflux. Cool the reaction mixture to ambient temperature and wash sequentially with water, 1M aqueous HCl, 5% aqueous NaHCO3 and brine. Concentrate the organic layer in vacuo to provide the desired intermediate as oil (2.54 g, 90%) that was used without any further purification.

후처리

  1. temperatureHeat
  2. temperatureat reflux
  3. washwash sequentially with water, 1M aqueous HCl, 5% aqueous NaHCO3 and brine
  4. concentrationConcentrate the organic layer in vacuo

출처 및 근거

ORD 기록
ord-7df4f380282749f5b6bf8baeae11266f
출처 데이터셋
uspto-grants-2013_11
특허 번호
US08580780B2

반응 노트

불러오는 중…