2-Bromododecanoic acid → 2-chlorododecanoic Acid

HRID 2210836

반응식

HRID 2210836 반응식
Br[CH:2]([CH2:6][CH2:7][CH2:8][CH2:9][CH2:10][CH2:11][CH2:12][CH2:13][CH2:14][CH3:15])[C:3]([OH:5])=[O:4].[Cl-:16].[Ca+2].[Cl-]>C(#N)C.[Cl-].C([N+](CC)(CC)CC)C>[Cl:16][CH:2]([CH2:6][CH2:7][CH2:8][CH2:9][CH2:10][CH2:11][CH2:12][CH2:13][CH2:14][CH3:15])[C:3]([OH:5])=[O:4]

참가 물질

5

반응물 2

HCID 669802-Bromododecanoic acidHCID 5284359Calcium Chloride

생성물 1

HCID 43873702-chlorododecanoic Acid

시약·촉매·용매 2

HCID 5946Tetraethylammonium Chloride촉매HCID 6342Acetonitrile용매

실험 절차

To 2-bromododecanoic acid (1 g), after having been dissolved in acetonitrile (50 ml ), were added calcium chloride (2 g) and tetraethylammonium chloride (1 g), and the mixture was heated under reflux for 4 hours. The reaction mixture was filtered, concentrated and distributed into ethyl acetate and water, and the ethyl acetate layer was dried over anhydrous sodium sulfate and concentrated to give 2-chlorododecanoic acid.

후처리

  1. temperaturethe mixture was heated
  2. temperatureunder reflux for 4 hours
  3. filtrationThe reaction mixture was filtered
  4. concentrationconcentrated
  5. dry with materialthe ethyl acetate layer was dried over anhydrous sodium sulfate
  6. concentrationconcentrated

출처 및 근거

ORD 기록
ord-1166962bf9cc4f59a854ba6f25ac7e21
출처 데이터셋
uspto-grants-1995_10
특허 번호
US05461036

연결된 노트

불러오는 중…