Triethylamine → 3-(4-Hydroxymethylphenyl)acrylic acid ethyl ester

HRID 2218117노트

반응식

HRID 2218117 반응식
Br[C:2]1[CH:9]=[CH:8][C:5]([CH2:6][OH:7])=[CH:4][CH:3]=1.C1(P(C2C=CC=CC=2)C2C=CC=CC=2)C=CC=CC=1.C(N(CC)CC)C.[C:36]([O:40][CH2:41][CH3:42])(=[O:39])[CH:37]=[CH2:38]>C([O-])(=O)C.[Pd+2].C([O-])(=O)C>[CH2:41]([O:40][C:36](=[O:39])[CH:37]=[CH:38][C:2]1[CH:9]=[CH:8][C:5]([CH2:6][OH:7])=[CH:4][CH:3]=1)[CH3:42]

참가 물질

6

반응물 4

HCID 8471TriethylamineHCID 8821Ethyl AcrylateHCID 11776TriphenylphosphineHCID 701194-Bromobenzyl alcohol

생성물 1

HCID 684575823-(4-Hydroxymethylphenyl)acrylic acid ethyl ester

시약·촉매·용매 1

HCID 167845palladium(II) acetate촉매

실험 절차

4-Bromobenzyl alcohol (10.5 g, 56.1 mmol), triphenylphosphine (0.5 g, 1.9 mmol) and palladium acetate (0.5 g, 2.2 mmol) were stirred at reflux in ethyl acrylate (20 mL) and triethylamine (100 mL) for 72 hours, then allowed to cool. The reaction mixture was filtered through celite (Diatomaceous Earth), then concentrated. The crude solid was purified by chromatography on silica gel (20% v/v ethyl acetate in petroleum ether) to afford the title compound as an oil.

후처리

  1. temperatureto cool
  2. filtrationThe reaction mixture was filtered through celite (Diatomaceous Earth)
  3. concentrationconcentrated
  4. customThe crude solid was purified by chromatography on silica gel (20% v/v ethyl acetate in petroleum ether)

출처 및 근거

ORD 기록
ord-cec32b817e254fb298ae4f7643043384
출처 데이터셋
uspto-grants-2008_08
특허 번호
US07410984B2

반응 노트

불러오는 중…