Cesium carbonate → 3-(6,7-Dimethoxy-quinolin-4-yloxy)-5,6,5'-trimethyl-[2,2']bipyridine

HRID 228824노트

반응식

HRID 228824 반응식
[CH3:1][C:2]1[CH:3]=[C:4]([OH:16])[C:5]([C:9]2[CH:14]=[CH:13][C:12]([CH3:15])=[CH:11][N:10]=2)=[N:6][C:7]=1[CH3:8].Cl[C:18]1[C:27]2[C:22](=[CH:23][C:24]([O:30][CH3:31])=[C:25]([O:28][CH3:29])[CH:26]=2)[N:21]=[CH:20][CH:19]=1.C(=O)([O-])[O-].[Cs+].[Cs+].[F-].[Cs+]>CN(C1C=CN=CC=1)C.O.CS(C)=O>[CH3:29][O:28][C:25]1[CH:26]=[C:27]2[C:22](=[CH:23][C:24]=1[O:30][CH3:31])[N:21]=[CH:20][CH:19]=[C:18]2[O:16][C:4]1[C:5]([C:9]2[CH:14]=[CH:13][C:12]([CH3:15])=[CH:11][N:10]=2)=[N:6][C:7]([CH3:8])=[C:2]([CH3:1])[CH:3]=1

참가 물질

8

반응물 4

HCID 10796Cesium carbonateHCID 25953Cesium fluorideHCID 4596104-Chloro-6,7-dimethoxyquinolineHCID 1363851085,6,5'-Trimethyl-[2,2']bipyridin-3-ol

생성물 1

HCID 577564513-(6,7-Dimethoxy-quinolin-4-yloxy)-5,6,5'-trimethyl-[2,2']bipyridine수율 29.4%

시약·촉매·용매 3

HCID 142844-(Dimethylamino)pyridine촉매HCID 679Dimethyl Sulfoxide용매HCID 962Water용매

반응 조건

온도
140 °C

실험 절차

Dimethyl sulfoxide (2.8 ml) was added to 5,6,5′-trimethyl-[2,2′]bipyridin-3-ol (60 mg), 4-chloro-6,7-dimethoxyquinoline (184 mg), cesium carbonate (274 mg), 4-(N,N-dimethylamino)-pyridine (51 mg), and cesium fluoride (64 mg) to prepare a solution which was then stirred at 140° C. overnight. The reaction solution was cooled to room temperature, water was then added to the reaction solution, and the mixture was extracted with ethyl acetate. The ethyl acetate layer was then washed with water and was dried over anhydrous sodium sulfate. The solvent was removed by distillation under the reduced pressure, and the residue was purified by thin layer chromatography using chloroform-methanol to give the title compound (33 mg, yield 29%).

후처리

  1. customto prepare a solution which
  2. temperatureThe reaction solution was cooled to room temperature
  3. extractionthe mixture was extracted with ethyl acetate
  4. washThe ethyl acetate layer was then washed with water
  5. dry with materialwas dried over anhydrous sodium sulfate
  6. customThe solvent was removed by distillation under the reduced pressure
  7. customthe residue was purified by thin layer chromatography

출처 및 근거

ORD 기록
ord-2d83b5505904495294df572729fa61b7
출처 데이터셋
uspto-grants-2009_07
특허 번호
US07560558B2

반응 노트

불러오는 중…