Acetyl chloride → 1-(6-Bromonaphthalen-2-yl)ethanone

HRID 35189

반응식

HRID 35189 반응식
[Br:1][C:2]1[CH:11]=[CH:10][C:9]2[C:4](=[CH:5][CH:6]=[CH:7][CH:8]=2)[CH:3]=1.[C:12](Cl)(=[O:14])[CH3:13].[Cl-].[Al+3].[Cl-].[Cl-]>[N+](C1C=CC=CC=1)([O-])=O>[Br:1][C:2]1[CH:11]=[CH:10][C:9]2[C:4](=[CH:5][CH:6]=[C:7]([C:12](=[O:14])[CH3:13])[CH:8]=2)[CH:3]=1

참가 물질

5

반응물 3

HCID 6367Acetyl chlorideHCID 113722-BromonaphthaleneHCID 6451240Aluminum(III) Chloride

생성물 1

HCID 124330821-(6-Bromonaphthalen-2-yl)ethanone

시약·촉매·용매 1

HCID 7416Nitrobenzene용매

반응 조건

온도
100 °C

실험 절차

A mixture of 41.4 g of 2-bromonaphthalene, 15.7 g of acetyl chloride and 28 g of aluminum chloride in 250 ml of nitrobenzene was stirred at 100° C. for 4 hours. The reaction mixture was poured onto ice water and the resulting solid filtered off, washed with water and distilled under reduced pressure. The distillate was recrystallized from hexane to yield 2-bromo-6-acetylnaphthalene.

후처리

  1. additionThe reaction mixture was poured onto ice water
  2. filtrationthe resulting solid filtered off
  3. washwashed with water
  4. distillationdistilled under reduced pressure
  5. customThe distillate was recrystallized from hexane

출처 및 근거

ORD 기록
ord-6b8ce0e0912b4f5087e0b932e9425f44
출처 데이터셋
uspto-grants-1988_08
특허 번호
US04766127

연결된 노트

불러오는 중…