Water → 2-(1-(3-(Trifluoromethyl)phenyl)ethylidene)hydrazinecarboxylic acid ethyl ester

HRID 54644

반응식

HRID 54644 반응식
[F:1][C:2]([F:13])([F:12])[C:3]1[CH:4]=[C:5]([C:9](=O)[CH3:10])[CH:6]=[CH:7][CH:8]=1.[C:14]([O:18][CH2:19][CH3:20])(=[O:17])[NH:15][NH2:16].O>C1(C)C=CC=CC=1.C1(C)C=CC(S(O)(=O)=O)=CC=1>[CH2:19]([O:18][C:14]([NH:15][N:16]=[C:9]([C:5]1[CH:6]=[CH:7][CH:8]=[C:3]([C:2]([F:13])([F:12])[F:1])[CH:4]=1)[CH3:10])=[O:17])[CH3:20]

참가 물질

6

반응물 3

HCID 962WaterHCID 20064Hydrazinecarboxylic acid, ethyl esterHCID 676823'-(Trifluoromethyl)acetophenone

생성물 1

HCID 544126252-(1-(3-(Trifluoromethyl)phenyl)ethylidene)hydrazinecarboxylic acid ethyl ester수율 100%

시약·촉매·용매 2

HCID 6101p-Toluenesulfonic acid촉매HCID 1140Toluene용매

실험 절차

m-Trifluoromethylacetophenone (74 g, 0.394 mole), ethyl carbazate (43 g, 0.413 mole), and catalytic p-toluenesulfonic acid (20 mg) were refluxed under N2 over a Dean-Stark trap in toluene (1.2 L) until the theoretical amount of water of reaction was removed (7.1 mL, 6 h). The solvent was then removed in vacuo and 2-(1-(3-(trifluoromethyl)phenyl)ethylidene)hydrazinecarboxylic acid ethyl ester (107 g, 100% yield) was obtained as a white solid which was recrystallized from cyclohexane, mp=94°-96° C.

후처리

  1. customwas removed (7.1 mL, 6 h)
  2. customThe solvent was then removed in vacuo

출처 및 근거

ORD 기록
ord-ccecdd3cd98e4bafa7a846607a35e3de
출처 데이터셋
uspto-grants-1997_04
특허 번호
US05623072

연결된 노트

불러오는 중…