Acetyl chloride → 1-(6-Bromonaphthalen-2-yl)ethanone

HRID 55755

반응식

HRID 55755 반응식
[Br:1][C:2]1[CH:11]=[CH:10][C:9]2[C:4](=[CH:5][CH:6]=[CH:7][CH:8]=2)[CH:3]=1.[C:12](Cl)(=[O:14])[CH3:13].[Al+3].[Cl-].[Cl-].[Cl-]>[N+](C1C=CC=CC=1)([O-])=O>[Br:1][C:2]1[CH:3]=[C:4]2[C:9](=[CH:10][CH:11]=1)[CH:8]=[C:7]([C:12](=[O:14])[CH3:13])[CH:6]=[CH:5]2

참가 물질

5

반응물 3

HCID 6367Acetyl chlorideHCID 113722-BromonaphthaleneHCID 6451240Aluminum(III) Chloride

생성물 1

HCID 124330821-(6-Bromonaphthalen-2-yl)ethanone수율 45.2%

시약·촉매·용매 1

HCID 7416Nitrobenzene용매

반응 조건

온도
100 °C

실험 절차

A mixture of 2-bromonaphthalene (41.4 g, 200 mmol), acetyl chloride (11.3 mL, 160 mmol), nitrobenzene (250 mL) and AlCl3 (28 g, 210 mmol) was stirred for 4 hours at 100° C. (oil bath temperature). The resulting reaction mixture was cooled, poured onto ice/water (100 mL) and filtered. The filtrate was washed with water (100 mL). The solvent (nitrobenzene) was removed by distillation. The resulting residue was crystallized from hexane to afford 18 g of desired product (36% yield).

후처리

  1. customThe resulting reaction mixture
  2. temperaturewas cooled
  3. additionpoured onto ice/water (100 mL)
  4. filtrationfiltered
  5. washThe filtrate was washed with water (100 mL)
  6. customThe solvent (nitrobenzene) was removed by distillation
  7. customThe resulting residue was crystallized from hexane

출처 및 근거

ORD 기록
ord-b60eeb7c6fab4f59b90f53646531cecb
출처 데이터셋
uspto-grants-2016_09
특허 번호
US09433609B2

연결된 노트

불러오는 중…