Acetyl chloride → N-(3-Bromobenzyl)-N-methylacetamide

HRID 561785

반응식

HRID 561785 반응식
[Br:1][C:2]1[CH:3]=[C:4]([CH:8]=[CH:9][CH:10]=1)[CH2:5][NH:6][CH3:7].CCN(C(C)C)C(C)C.[C:20](Cl)(=[O:22])[CH3:21]>CN(C)C1C=CN=CC=1.CN(C=O)C>[Br:1][C:2]1[CH:3]=[C:4]([CH:8]=[CH:9][CH:10]=1)[CH2:5][N:6]([CH3:7])[C:20](=[O:22])[CH3:21]

참가 물질

6

반응물 3

HCID 6367Acetyl chlorideHCID 81531DiisopropylethylamineHCID 457588Benzenemethanamine, 3-bromo-N-methyl-

생성물 1

HCID 57956102N-(3-Bromobenzyl)-N-methylacetamide

시약·촉매·용매 2

HCID 142844-(Dimethylamino)pyridine촉매HCID 6228Dimethylformamide용매

실험 절차

To a DMF (0.1 M) solution of 3-bromo-N-methylbenzylamine (1 eq.), Hunig's base (3 eq) and 4-(dimethylamino)pyridine (5% loading) was added acetyl chloride (1.5 eq). The resulting reaction mixture was stirred at RT for 16 h. After quenching the reaction with sat. aq. NaHCO3, the mixture was extracted with EtOAc. The organic extract was washed with 10% aq. HCl, sat. aq. NaHCO3, and brine. Drying over Na2SO4, filtration and concentration of the filtrate in vacuo afforded the crude product as a yellow oil. Purification by way of flash chromatography (SiO2, 4:1 (v/v) Hex:EtOAc→EtOAc) afforded the title compound as a yellow oil.

후처리

  1. customThe resulting reaction mixture
  2. customAfter quenching
  3. customthe reaction with sat. aq. NaHCO3
  4. extractionthe mixture was extracted with EtOAc
  5. extractionThe organic extract
  6. washwas washed with 10% aq. HCl, sat. aq. NaHCO3, and brine
  7. dry with materialDrying over Na2SO4, filtration and concentration of the filtrate in vacuo
  8. customafforded the crude product as a yellow oil
  9. customPurification by way of flash chromatography (SiO2, 4:1 (v/v) Hex:EtOAc→EtOAc)

출처 및 근거

ORD 기록
ord-249c480083964669afc97ff8a33b281e
출처 데이터셋
uspto-grants-2011_11
특허 번호
US08063105B2

연결된 노트

불러오는 중…