Methyl iodide → HCID 13756050, 화합물

HRID 580694노트

반응식

HRID 580694 반응식
[OH-].[Na+].[NH2:3][C:4]1[C:5]2[C:10]([N:11]=[C:12]3[C:17]=1[C:16](=[O:18])[CH2:15][CH2:14][CH2:13]3)=[CH:9][CH:8]=[CH:7][CH:6]=2.[CH3:19]I>ClCCl.S([O-])(O)(=O)=O.C([N+](CCCC)(CCCC)CCCC)CCC>[CH3:19][NH:3][C:4]1[C:5]2[C:10]([N:11]=[C:12]3[C:17]=1[C:16](=[O:18])[CH2:15][CH2:14][CH2:13]3)=[CH:9][CH:8]=[CH:7][CH:6]=2

참가 물질

6

반응물 3

HCID 6328Methyl iodideHCID 14798Sodium HydroxideHCID 1843619-amino-3,4-dihydroacridin-1(2H)-one

생성물 1

HCID 13756050HCID 13756050, 화합물수율 70%

시약·촉매·용매 2

HCID 94433Tetrabutylammonium hydrogen sulfate촉매HCID 6344Dichloromethane용매

실험 절차

In 150 ml of dichloromethane and 100 ml of 50% NaOH were added 5.00 g of 9-amino-3,4-dihydroacridin-1(2H)-one and 0.80 g (0.1 eq) of tetrabutylammonium hydrogensulfate. The biphasic mixture was mechanically stirred for 0.5 hour and thereafter 4.4 ml (3 eq) of CH3I was added. The reaction mixture was stirred overnight. Analysis of the reaction mixture indicated that the starting material was completely consumed. The reaction mixture was poured into cold water and the dichloromethane layer was evaporated, dried over MgSO4 and filtered through alumina and the solvent was evaporated to afford a solid. The solid was recrystallized from dichloromethane/hexanes to yield 3.73 g (70%) of crystalline product after drying, melting point 116°-117° C.

후처리

  1. stirringThe reaction mixture was stirred overnight
  2. customwas completely consumed
  3. additionThe reaction mixture was poured into cold water
  4. customthe dichloromethane layer was evaporated
  5. dry with materialdried over MgSO4
  6. filtrationfiltered through alumina
  7. customthe solvent was evaporated
  8. customto afford a solid
  9. customThe solid was recrystallized from dichloromethane/hexanes

출처 및 근거

ORD 기록
ord-02adc39c17704dd8924a048cff6c18b6
출처 데이터셋
uspto-grants-1988_06
특허 번호
US04754050

반응 노트

불러오는 중…