N-bromobutanimide → 2-(Bromomethyl)-1-chloro-4-iodobenzene

HRID 70244노트

반응식

HRID 70244 반응식
[Cl:1][C:2]1[CH:7]=[CH:6][C:5]([I:8])=[CH:4][C:3]=1[CH3:9].[Br:10]N1C(=O)CCC1=O>ClCCl.O.N(C(C)(C)C#N)=NC(C)(C)C#N>[Br:10][CH2:9][C:3]1[CH:4]=[C:5]([I:8])[CH:6]=[CH:7][C:2]=1[Cl:1]

참가 물질

6

반응물 2

HCID 67184N-bromobutanimideHCID 42009962-Chloro-5-iodotoluene

생성물 1

HCID 117390382-(Bromomethyl)-1-chloro-4-iodobenzene수율 97.3%

시약·촉매·용매 3

HCID 6547Azobisisobutyronitrile촉매HCID 962Water용매HCID 6344Dichloromethane용매

실험 절차

To a mixture of 2-chloro-5-iodotoluene (4.07 g, 16.12 mmol), N-bromosuccinimide (3.16 g, 17.73 mmol) in dichloromethane (258 mL) and water (258 mL) was added 2,2′-azodiisobutyronitrile (0.132 g, 0.81 mmol). The reaction mixture was irradiated with a halogen sun lamp (150 watt) for 2 h and then cooled to room temperature. The two-phase reaction mixture was separated, and the aqueous layer was extracted with dichloromethane (50 mL). The combined organic layers were washed with water (2×150 mL), dried over magnesium sulfate, filtered and concentrated under reduced pressure to provide the title compound as an orange oil (5.20 g).

후처리

  1. customThe reaction mixture was irradiated with a halogen sun lamp (150 watt) for 2 h
  2. customThe two-phase reaction mixture
  3. customwas separated
  4. extractionthe aqueous layer was extracted with dichloromethane (50 mL)
  5. washThe combined organic layers were washed with water (2×150 mL)
  6. dry with materialdried over magnesium sulfate
  7. filtrationfiltered
  8. concentrationconcentrated under reduced pressure

출처 및 근거

ORD 기록
ord-b862707337964a4b86f36c2f868d1800
출처 데이터셋
uspto-grants-2014_09
특허 번호
US08822521B2

반응 노트

불러오는 중…