1-Butanol → Butyl pyruvate

HRID 868772

반응식

HRID 868772 반응식
[C:1]([OH:6])(=[O:5])[C:2]([CH3:4])=[O:3].[CH2:7](O)[CH2:8][CH2:9][CH3:10]>O.C1(C)C=CC(S(O)(=O)=O)=CC=1.C1(C)C=CC=CC=1>[C:1]([O:6][CH2:7][CH2:8][CH2:9][CH3:10])(=[O:5])[C:2]([CH3:4])=[O:3]

참가 물질

5

반응물 2

HCID 2631-ButanolHCID 1060Pyruvic Acid

생성물 1

HCID 523883Butyl pyruvate수율 70.1%

시약·촉매·용매 2

HCID 521998p-Toluenesulfonic acid monohydrate촉매HCID 1140Toluene용매

반응 조건

온도
25 °C

실험 절차

First, a toluene (1 L) solution of pyruvic acid (440 g, 5.0 mol), n-butanol (371 g, 5.0 mol) and p-toluenesulfonic acid monohydrate (2.5 g) was heated and refluxed for 16 hours while removing water under a nitrogen gas stream, whereby a first reaction solution was obtained. Next, the first reaction solution was cooled to room temperature (25° C.). Thereafter, toluene was removed under reduced pressure (40 mmHg) using an evaporator, and the residue was purified by reduced pressure distillation (40 mmHg, 93 to 100° C.), whereby butyl pyruvate (505 g, yield 70%) was obtained.

후처리

  1. temperaturerefluxed for 16 hours
  2. customwhile removing water under a nitrogen gas stream, whereby a first reaction solution
  3. customwas obtained
  4. customThereafter, toluene was removed under reduced pressure (40 mmHg)
  5. customan evaporator
  6. distillationthe residue was purified by reduced pressure distillation (40 mmHg, 93 to 100° C.)

출처 및 근거

ORD 기록
ord-e3f4b785506842d7aa2cf4bb89d386b6
출처 데이터셋
uspto-grants-2015_03
특허 번호
US08968975B2

연결된 노트

불러오는 중…