Potassium Carbonate → HCID 68485568, compound

HRID 1039600Notes

Reaction equation

HRID 1039600 reaction equation
[CH2:1]([O:3][C:4]([N:6]1[CH2:11][CH2:10][CH:9]([O:12]S(C)(=O)=O)[CH2:8][CH2:7]1)=[O:5])[CH3:2].[F:17][C:18]([F:28])([F:27])[O:19][C:20]1[CH:25]=[CH:24][CH:23]=[CH:22][C:21]=1O.C(=O)([O-])[O-].[K+].[K+]>[Cl-].C([N+](CCCC)(CCCC)CCCC)CCC.O>[CH2:1]([O:3][C:4]([N:6]1[CH2:11][CH2:10][CH:9]([O:12][C:23]2[CH:22]=[CH:21][C:20]([O:19][C:18]([F:17])([F:27])[F:28])=[CH:25][CH:24]=2)[CH2:8][CH2:7]1)=[O:5])[CH3:2]

Participants

6

Reactant 3

HCID 11430Potassium CarbonateHCID 27772992-(Trifluoromethoxy)phenolHCID 222729621-(Ethoxycarbonyl)piperidin-4-yl methanesulfonate

Product 1

HCID 68485568HCID 68485568, compound

Reagents, catalysts & solvents 2

HCID 70681Tetrabutylammonium ChlorideCatalystHCID 962WaterSolvent

Procedure

1-ethoxycarbonyl-4-mesyloxypiperidine (13.6 g), trifluoromethoxyphenol (4.0 g), tetrabutylammonium chloride (1.2 g) and potassium carbonate (7.72 g) were suspended in water (20 mL) and the suspension was refluxed for 3 hours. The reaction solution was cooled to room temperature, and then the reaction product was extracted with toluene (24 mL). The extract was washed with water (20 mL×2), and then the solvent was concentrated under reduced pressure to obtain a target compound as a light yellow oily substance. The yield amount was 12.03 g (%). The obtained target compound was used, for the subsequent reaction without being purified.

Workup

  1. temperaturethe suspension was refluxed for 3 hours
  2. extractionthe reaction product was extracted with toluene (24 mL)
  3. washThe extract was washed with water (20 mL×2)
  4. concentrationthe solvent was concentrated under reduced pressure
  5. customto obtain a target compound as a light yellow oily substance
  6. customThe obtained target compound was used, for the subsequent reaction
  7. customwithout being purified

Sources & evidence

ORD record
ord-4347b1d0d1db4f17b90a13c3adccda3d
Source dataset
uspto-grants-2013_10
Patent number
US08552188B2

Reaction notes

Loading…