Dichloromethane → 3-(2-Thienyl)-propanoic acid chloride

HRID 1109168Notes

Reaction equation

HRID 1109168 reaction equation
[S:1]1[CH:5]=[CH:4][CH:3]=[C:2]1[CH2:6][CH2:7][C:8]([OH:10])=O.C(Cl)[Cl:12]>C(Cl)(=O)C(Cl)=O.CN(C)C=O>[S:1]1[CH:5]=[CH:4][CH:3]=[C:2]1[CH2:6][CH2:7][C:8]([Cl:12])=[O:10]

Participants

5

Reactant 2

HCID 6344DichloromethaneHCID 7031693-(2-Thienyl)propanoic acid

Product 1

HCID 149601613-(2-Thienyl)-propanoic acid chloride

Reagents, catalysts & solvents 2

HCID 6228DimethylformamideCatalystHCID 65578Oxalyl chlorideSolvent

Procedure

To a solution of 5.0 g (0.032 mol) of 3-(2-thienyl)propionic acid in 2 ml of methylene chloride and 25 ml of oxalyl chloride was added three drops of N,N-dimethylformamide slowly. Following evolution of the gas the reaction mixture was concentrated under vacuum and 20 ml of hexane was added to the residue. The resulting mixture was filtered and the filtrate was concentrated under vacuum. The resulting compound, 3-(2-thienyl)propionyl chloride, was used directly in the following reaction.

Workup

  1. concentrationwas concentrated under vacuum and 20 ml of hexane
  2. additionwas added to the residue
  3. filtrationThe resulting mixture was filtered
  4. concentrationthe filtrate was concentrated under vacuum
  5. customThe resulting compound, 3-(2-thienyl)propionyl chloride, was used directly in the following reaction

Sources & evidence

ORD record
ord-dca96b48d0964804af63f47cd2e51644
Source dataset
uspto-grants-1994_06
Patent number
US05319087

Reaction notes

Loading…