3-Bromopyridine → Biphenyl

HRID 1286040노트

반응식

HRID 1286040 반응식
Brc1cccnc1.Nc1ccc(-c2ccccc2)cn1>CC(C)(C)[P](C(C)(C)C)(C(C)(C)C)->[Pd]1([Cl])<-[NH2]c2ccccc2-c2cccc[c]21.CN(C)C(=NC(C)(C)C)N(C)C.CS(C)=O>c1ccc(-c2ccc(Nc3cccnc3)nc2)cc1

참가 물질

9

반응물 2

HCID 122863-BromopyridineHCID 1050975-Phenyl-2-pyridinamine

생성물 4

HCID 7095BiphenylHCID 122863-BromopyridineHCID 1050975-Phenyl-2-pyridinamineHCID 175070979HCID 175070979, 화합물

시약·촉매·용매 3

HCID 35715812-tert-Butyl-1,1,3,3-tetramethylguanidine시약HCID 178454887HCID 178454887, 화합물시약HCID 679Dimethyl Sulfoxide용매4회

실험 절차

The Mosquito was used to combine the source plate solutions by multi-aspiration of 250 nL of each of the four reaction components and then to dose the resulting reaction mixture (1 uL) into a 1536-well plate

후처리

  1. addition기록된 절차가 없습니다
  2. aliquot기록된 절차가 없습니다
  3. addition기록된 절차가 없습니다

출처 및 근거

ORD 기록
ord-a26f18fc596a416898cbd16d42f3f616
출처 데이터셋
HTE Pd-catalyzed cross-coupling screen
원본 링크
출처 보기

반응 노트

불러오는 중…