3-Bromopyridine → Biphenyl

HRID 1287003노트

반응식

HRID 1287003 반응식
Brc1cccnc1.CCOC(=O)/C=C/c1ccccc1>CC(C)(C)[P](C(C)(C)C)(C(C)(C)C)->[Pd]1([Cl])<-[NH2]c2ccccc2-c2cccc[c]21.CCN=P(N=P(N(C)C)(N(C)C)N(C)C)(N(C)C)N(C)C.CS(C)=O>CCOC(=O)/C=C(\c1ccccc1)c1cccnc1

참가 물질

9

반응물 2

HCID 122863-BromopyridineHCID 637758Ethyl Cinnamate

생성물 4

HCID 7095BiphenylHCID 122863-BromopyridineHCID 637758Ethyl CinnamateHCID 178470870HCID 178470870, 화합물

시약·촉매·용매 3

HCID 33931062,N'3,N'3,N3,N3,N'5,N'5,N5,N5-nonamethyl-2,4,6-triaza-3lambda5,5lambda5-diphosphaocta-3,5-diene-3,3,5,5-tetramine시약HCID 178454887HCID 178454887, 화합물시약HCID 679Dimethyl Sulfoxide용매4회

실험 절차

The Mosquito was used to combine the source plate solutions by multi-aspiration of 250 nL of each of the four reaction components and then to dose the resulting reaction mixture (1 uL) into a 1536-well plate

후처리

  1. addition기록된 절차가 없습니다
  2. aliquot기록된 절차가 없습니다
  3. addition기록된 절차가 없습니다

출처 및 근거

ORD 기록
ord-cd6f2d8c76554fab9484e910aed04285
출처 데이터셋
HTE Pd-catalyzed cross-coupling screen
원본 링크
출처 보기

반응 노트

불러오는 중…