Water → 1,3-Di(2-methylphenethyl)tetramethyldisiloxane

HRID 1463523Notes

Reaction equation

HRID 1463523 reaction equation
[CH3:1][C:2]([C:4]1C=C[CH:7]=[CH:6][CH:5]=1)=C.[CH3:10][SiH:11]([CH3:13])Cl.[CH3:14][C:15]1[CH:26]=[CH:25][CH:24]=[CH:23][C:16]=1[CH2:17][CH2:18][Si:19]([CH3:22])([CH3:21])Cl.[OH2:27].[CH:28](O)([CH3:30])[CH3:29]>[H+].[H+].Cl[Pt-2](Cl)(Cl)(Cl)(Cl)Cl>[CH3:14][C:15]1[CH:26]=[CH:25][CH:24]=[CH:23][C:16]=1[CH2:17][CH2:18][Si:19]([CH3:22])([CH3:21])[O:27][Si:11]([CH3:13])([CH3:10])[CH2:29][CH2:28][C:30]1[CH:7]=[CH:6][CH:5]=[CH:4][C:2]=1[CH3:1]

Participants

7

Reactant 5

HCID 962WaterHCID 3776IsopropanolHCID 7407Alpha-MethylstyreneHCID 66108ChlorodimethylsilaneHCID 190907002-Methylphenethyldimethylchlorosilane

Product 1

HCID 190907011,3-Di(2-methylphenethyl)tetramethyldisiloxane

Reagents, catalysts & solvents 1

HCID 61859Chloroplatinic acidCatalyst

Conditions

Temperature
70 °C

Procedure

The following were charged to a 1 L roundbottom flask equipped with stirrer, thermometer, and addition funnel and heated to 70° C: 375 g (3.15 mol) alpha-methylstyrene and 0.6 mL 1% isopropanolic chloroplatinic acid solution. 285 g (3.0 mol) dimethylchlorosilane was then dripped in from the addition funnel over 1 hour. The reaction was subsequently maintained at 80° C. for 1 hour and cooled. 424 g (2 mol) of the 2-methylphenethyldimethylchlorosilane product was dripped into a mixture of 300 g water and 100 g isopropyl alcohol. The resulting reaction mixture was washed with water 3 times, the water (lower) layer was removed, and the reaction mixture (upper layer) was heated in vacuo to give 350 g (95% of the theoretical yield) 1,3-di(2-methylphenethyl)tetramethyldisiloxane. This 1,3-di(2-methylphenethyl)tetramethyldisiloxane had a refractive index of 1.505. a viscosity of 9.3 centistokes, and a boiling point of 160° C./0.5 mmHg.

Workup

  1. additionThe following were charged to a 1 L roundbottom flask
  2. customequipped with stirrer
  3. additionthermometer, and addition funnel
  4. temperatureThe reaction was subsequently maintained at 80° C. for 1 hour
  5. temperaturecooled
  6. customThe resulting reaction mixture
  7. washwas washed with water 3 times
  8. customthe water (lower) layer was removed
  9. temperaturethe reaction mixture (upper layer) was heated in vacuo
  10. customto give 350 g (95% of the

Sources & evidence

ORD record
ord-982c29cfba934b5d93b9ab67da6ee5bd
Source dataset
uspto-grants-1994_04
Patent number
US05300669

Reaction notes

Loading…