反应详情

A microwave vial was charged with amino-6-bromo-5-trifluoromethyl-pyridine-2-carboxylic acid methyl ester (Intermediate A4) (0.5 g, 1.754 mmol), cyclopropylboronic acid (0.753 g, 8.77 mmol), and 1,1′Bis(diphenylphosphosphino) ferrocene palladium dichloride (0.143 g, 0.175 mmol). The mixture was taken up as a solution in THF (6 ml) and flushed with N2, sealed and heated using microwave radiation at 150° C. for 20 minutes. The reaction mixture was filtered through Celite® (filter material) and washed through with EtOAc (20 ml). The filtrate was partitioned between EtOAc (30 ml) and water (50 ml). The phases were separated and the organic portion was washed with brine (30 ml), dried over MgSO4, filtered and concentrated under vacuum.

1. customflushed with N2
2. customsealed
3. temperatureheated
4. customat 150° C.
5. customfor 20 minutes
6. filtrationThe reaction mixture was filtered through Celite® (filter material)
7. washwashed through with EtOAc (20 ml)
8. customThe filtrate was partitioned between EtOAc (30 ml) and water (50 ml)
9. customThe phases were separated
10. washthe organic portion was washed with brine (30 ml)
11. dry with materialdried over MgSO4
12. filtrationfiltered
13. concentrationconcentrated under vacuum