2-Bromopyridine → HCID 68408479, compound

HRID 888021Notes

Reaction equation

HRID 888021 reaction equation
[C:1]([O:5][C:6]([NH:8][C:9]1[CH:14]=[CH:13][CH:12]=[CH:11][C:10]=1[NH:15][C:16](=[O:32])[C:17]1[CH:22]=[CH:21][C:20](B2OC(C)(C)C(C)(C)O2)=[CH:19][CH:18]=1)=[O:7])([CH3:4])([CH3:3])[CH3:2].Br[C:34]1[CH:39]=[CH:38][CH:37]=[CH:36][N:35]=1.C(=O)([O-])O.[Na+]>C1C=CC([P]([Pd]([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)[P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)=CC=1.COCCOC>[C:1]([O:5][C:6]([NH:8][C:9]1[CH:14]=[CH:13][CH:12]=[CH:11][C:10]=1[NH:15][C:16](=[O:32])[C:17]1[CH:18]=[CH:19][C:20]([C:34]2[CH:39]=[CH:38][CH:37]=[CH:36][N:35]=2)=[CH:21][CH:22]=1)=[O:7])([CH3:4])([CH3:2])[CH3:3]

Participants

6

Reactant 3

HCID 79732-BromopyridineHCID 516892Sodium BicarbonateHCID 59830883N-(2-t-Butoxycarbonylaminophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide

Product 1

HCID 68408479HCID 68408479, compoundYield 88.3%

Reagents, catalysts & solvents 2

HCID 178418397HCID 178418397, compoundCatalystHCID 80711,2-DimethoxyethaneSolvent

Procedure

N-(2-t-Butoxycarbonylaminophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (Method 13; 132 mg, 0.3 mmol), 2-bromopyridine (40 mg, 0.25 mmol), tetrakis(triphenylphosphine)palladium (4 mg, 0.004 mmol), 1,2-dimethyoxyethane (1.5 ml) and a saturated aqueous solution of sodium hydrogen carbonate (1.5 ml) were stirred at 80-85° C. under an atmosphere of argon for 24 hours. The mixture was allowed to cool before being partitioned between ethyl acetate and water. The organics were separated, washed with brine, dried over magnesium sulfate, filtered and evaporated to yield the title compound (86 mg, 74%) which was used in the next reaction without further purification; Mass Spectrum: M+H+ 390.

Workup

  1. temperatureto cool
  2. custombefore being partitioned between ethyl acetate and water
  3. customThe organics were separated
  4. washwashed with brine
  5. dry with materialdried over magnesium sulfate
  6. filtrationfiltered
  7. customevaporated

Sources & evidence

ORD record
ord-a0140d29ad57434da1eb127c4894f432
Source dataset
uspto-grants-2012_08
Patent number
US08247562B2

Reaction notes

Loading…