Water → 1-Bromo-4-(pentyloxy)benzene

HRID 1938145Notizen

Reaktionsgleichung

Reaktionsgleichung von HRID 1938145
C(=O)([O-])[O-].[Na+].[Na+].BrC1[CH:13]=[CH:12][C:11]([Br:14])=[CH:10]N=1.[CH2:15]([O:17][CH2:18][CH3:19])[CH3:16].O.[CH3:21][CH2:22][CH2:23]CC>C1C=CC([P]([Pd]([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)[P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)=CC=1>[Br:14][C:11]1[CH:12]=[CH:13][C:15]([O:17][CH2:18][CH2:19][CH2:21][CH2:22][CH3:23])=[CH:16][CH:10]=1

Komponenten

7

Edukt 5

HCID 962WaterHCID 3283Diethyl EtherHCID 8003PentaneHCID 10340Sodium CarbonateHCID 693532,5-Dibromopyridine

Produkt 1

HCID 70169051-Bromo-4-(pentyloxy)benzene

Reagenzien, Katalysatoren, Lösungsmittel 1

HCID 178418397HCID 178418397, VerbindungKatalysator

Versuchsvorschrift

To a solution of 1.44 g (6.92 mmol) of a subtitled compound of Preparation 2B in 50 ml of toluene and 20 ml of methanol under nitrogen, was added 15.5 ml (31.1 mmol) a 2M sol. of sodium carbonate which resulted in the formation of a white precipitate. To the resultant mixture, was added 800 mg (0.69 mmol) of palladium tetrakis (triphenylphosphine), followed by 1.64 g (6.92 mmol) of 2,5-dibromopyridine. The resultant reaction mixture was reacted for approximately three hours, forty-five minutes at reflux temperature. When the reaction was substantially complete, as indicated by TLC, the mixture was cooled to room temperature and allowed to stir overnight. The reaction mixture was placed in a separatory funnel and combined with diethyl ether and water. The resultant layers were separated and the organic layer was dried over sodium sulfate, filtered and then concentrated in vacuo to provide a residue. This residue was redissolved in pentane and filtered to provide 0.95 g of the desired compound. The filtrate was recrystallized to provide an additional 1.4 g of the desired compound. These solids were combined and used without further purification. ##STR20##

Aufarbeitung

  1. customresulted in the formation of a white precipitate
  2. customThe resultant reaction mixture
  3. customwas reacted for approximately three hours, forty-five minutes
  4. temperatureat reflux temperature
  5. customThe reaction mixture was placed in a separatory funnel
  6. customThe resultant layers were separated
  7. dry with materialthe organic layer was dried over sodium sulfate
  8. filtrationfiltered
  9. concentrationconcentrated in vacuo
  10. customto provide a residue
  11. filtrationfiltered

Quellen und Nachweise

ORD-Eintrag
ord-10eadefe04374bac9be7508e13e335a6
Quelldatensatz
uspto-grants-1997_12
Patentnummer
US05693611

Notizen zur Reaktion

Wird geladen…