Water → HCID 88769187, compound

HRID 1680121Notes

Reaction equation

HRID 1680121 reaction equation
[C:1]1([CH:8]=[CH:7][CH:6]=[C:4]([OH:5])[CH:3]=1)[OH:2].[C:9]1([O:20][C:21]2[C:26]([Br:27])=[C:25]([Br:28])[C:24]([Br:29])=[C:23]([Br:30])[C:22]=2[Br:31])[C:14]([Br:15])=[C:13]([Br:16])[C:12]([Br:17])=[C:11]([Br:18])[C:10]=1[Br:19].C(=O)([O-])[O-].[K+].[K+].O>ClC1C=CC=CC=1.CC(N(C)C)=O>[C:1]1([CH:8]=[CH:7][CH:6]=[C:4]([OH:5])[CH:3]=1)[OH:2].[C:21]1([O:20][C:9]2[C:10]([Br:19])=[C:11]([Br:18])[C:12]([Br:17])=[C:13]([Br:16])[C:14]=2[Br:15])[C:26]([Br:27])=[C:25]([Br:28])[C:24]([Br:29])=[C:23]([Br:30])[C:22]=1[Br:31]

Participants

7

Reactant 4

HCID 962WaterHCID 5054ResorcinolHCID 11430Potassium CarbonateHCID 144102,2',3,3',4,4',5,5',6,6'-Decabromodiphenyl ether

Product 1

HCID 88769187HCID 88769187, compound

Reagents, catalysts & solvents 2

HCID 7964ChlorobenzeneSolventHCID 31374DimethylacetamideSolvent

Conditions

Temperature
146 °C

Procedure

A resorcinol-decabromodiphenyl ether oligomer was prepared by heating 16.5 grams (0.15 mole) resorcinol with 143.9 grams (0.15 mole) decabromodiphenyl ether (DBDPE) in 300 ml chlorobenzene and 300 ml dimethyl acetamide (DMAC). 30 g of anhydrous potassium carbonate was also added as the base required to carry out the reaction. The mixture was heated at reflux (146° C.) for 5 hours and water formed by the reaction was removed using a modified Dean Stark trap. The reaction mixture was filtered hot and the oligomer was precipitated by pouring the reaction mixture into 2 liters of methanol. The solid product was collected and dried. Oligomer recovered was 105 grams.

Workup

  1. customthe reaction
  2. temperatureThe mixture was heated
  3. customwas removed
  4. filtrationThe reaction mixture was filtered hot
  5. customthe oligomer was precipitated
  6. additionby pouring the reaction mixture into 2 liters of methanol
  7. customThe solid product was collected
  8. customdried
  9. customOligomer recovered

Sources & evidence

ORD record
ord-e2c6935c88254213b0e43d88c140345c
Source dataset
uspto-grants-1981_06
Patent number
US04272429

Reaction notes

Loading…