2-Bromo-1-(4-hydroxyphenyl)ethanone → HCID 178444636, compound

HRID 1812810Notes

Reaction equation

HRID 1812810 reaction equation
C#CCCCCC=O.Oc1ccc(C(=O)CBr)cc1>NC(=O)C1CCCN1.C1=CC=C(C(=C1)C2=C3C=C(C(=O)C(=C3OC4=C(C(=C(C=C24)Br)O)Br)Br)Br)C(=O)O.[Na].[Na].CN(C)C=O.Cc1cccc(C)n1>C#CCCC[C@@H](C=O)CC(=O)c1ccc(O)cc1.C#CCCC[C@H](C=O)CC(=O)c1ccc(O)cc1

Participants

8

Reactant 3

HCID 49642-Bromo-1-(4-hydroxyphenyl)ethanoneHCID 79372,6-LutidineHCID 11355455Hept-6-ynal

Product 2

HCID 178444636HCID 178444636, compoundHCID 178444637HCID 178444637, compound

Reagents, catalysts & solvents 3

HCID 550774Pyrrolidine-2-carboxamideCatalystHCID 124202469Eosin Y disodium salt, analytical standardCatalystHCID 6228DimethylformamideSolvent5×

Conditions

Temperature
22 °C

Workup

  1. aliquot4 uL mixture of each reacted solution was collected and diluted with 36 uL ACN
  2. addition4 uL mixture of each reacted solution was collected and diluted with 36 uL ACN
  3. additionchiral resolving regent (150 mM in DCM, 40 uL)
  4. additionCuI with DIPEA (400 mM in ACN) 40 uL
  5. additioninternal standard 1-phenylprop-2-yn-1-ol (4) (25 mM in ACN) 40 uL
  6. stirringNo procedure recorded
  7. aliquotAfter the reaction, 10 uL of supernatant for each reaction was transferred to another 96-well plate
  8. additionAfter the reaction, 10 uL of supernatant for each reaction was transferred to another 96-well plate and diluted with 190 uL ACN before the IM-MS analysis

Sources & evidence

ORD record
ord-6d926b2eeade4e3c90f7c3370e6c61d9
Source dataset
Dataset from `Ultra-high-throughput mapping of the chemical space of asymmetric catalysis enables accelerated reaction discovery`

Reaction notes

Loading…