Hydrochloric Acid → HCID 86739642, compound

HRID 2418203Notes

Reaction equation

HRID 2418203 reaction equation
[C:1]1([CH2:7][C:8]([O:10][C:11]2[CH:16]=[CH:15][C:14]([CH:17]([N:21]3[CH2:24][CH:23]([NH:25][C:26](=[O:63])[C:27]([C:30]4[CH:35]=[CH:34][C:33]([O:36][CH2:37][CH2:38][CH:39]([C:60]([OH:62])=[O:61])[NH:40]C(C5C=CC=CC=5)(C5C=CC=CC=5)C5C=CC=CC=5)=[CH:32][CH:31]=4)=[N:28][OH:29])[C:22]3=[O:64])[C:18]([OH:20])=[O:19])=[CH:13][CH:12]=2)=[O:9])[CH:6]=[CH:5][CH:4]=[CH:3][CH:2]=1.Cl>C(O)(=O)C.C(=O)(O)[O-].[Na+]>[NH2:40][CH:39]([C:60]([OH:62])=[O:61])[CH2:38][CH2:37][O:36][C:33]1[CH:32]=[CH:31][C:30]([C:27](=[N:28][OH:29])[C:26]([NH:25][CH:23]2[CH2:24][N:21]([CH:17]([C:14]3[CH:15]=[CH:16][C:11]([O:10][C:8](=[O:9])[CH2:7][C:1]4[CH:2]=[CH:3][CH:4]=[CH:5][CH:6]=4)=[CH:12][CH:13]=3)[C:18]([OH:20])=[O:19])[C:22]2=[O:64])=[O:63])=[CH:35][CH:34]=1

Participants

5

Reactant 2

HCID 313Hydrochloric AcidHCID 86739643HCID 86739643, compound

Product 1

HCID 86739642HCID 86739642, compoundYield 39%

Reagents, catalysts & solvents 2

HCID 176Acetic AcidSolventHCID 516892Sodium BicarbonateSolvent

Procedure

2-[4-(2-Phenylacetoxy)phenyl]-2-[3-[2-{4-(3-carboxy-3-tritylaminopropoxy)phenyl}-2-hydroxyiminoacetamido]-2-oxo-1-azetidinyl]acetic acid (0.5 g.) was dissolved in 80% acetic acid (10 ml.) and the mixture was stirred for 45 minutes. Insoluble materials were filtered off from the reaction mixture and the filtrate was evaporated to dryness under reduced pressure. The residue obtained was triturated with ethyl acetate to give a powder (0.27 g.). This powder (0.2 g.) was dissolved in an aqueous sodium bicarbonate and the solution was adjusted to pH 3 with 10% hydrochloric acid to give crystals of 2-[3-[2-{4-(3-amino-3-carboxypropoxy)phenyl}-2-hydroxyiminoacetamido]-2-oxo-1-azetidinyl]-2-[4-(2-phenylacetoxy)phenyl]acetic acid (0.14 g.).

Workup

  1. filtrationInsoluble materials were filtered off from the reaction mixture
  2. customthe filtrate was evaporated to dryness under reduced pressure
  3. customThe residue obtained
  4. customwas triturated with ethyl acetate
  5. customto give a powder (0.27 g.)

Sources & evidence

ORD record
ord-126e2bf5e179424eabd8ba3bbed44b3b
Source dataset
uspto-grants-1984_09
Patent number
US04472300

Reaction notes

Loading…