tert-Butyl (R)-3-(2-acetamidopropan-2-yl)-6-chloro-5-methyl-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate → Biphenyl

HRID 608088노트

반응식

HRID 608088 반응식
CC(=O)NC(C)(C)[C@@H]1CC2(CCN(C(=O)OC(C)(C)C)CC2)c2cc(Cl)c(C)cc21.CC(C)(C)N=P(N1CCCC1)(N1CCCC1)N1CCCC1.Cc1cc(O)ccc1B1OC(C)(C)C(C)(C)O1>CC(C)(C)[PH](C(C)(C)C)(C(C)(C)C)[Pd]1([Cl])[NH]c2ccccc2-c2cccc[c]21.CCC(C)(C)O.CS(C)=O.O>CC(=O)NC(C)(C)[C@@H]1CC2(CCN(C(=O)OC(C)(C)C)CC2)c2cc(-c3ccc(O)cc3C)c(C)cc21

참가 물질

10

반응물 2

HCID 24805585tert-Butyl (R)-3-(2-acetamidopropan-2-yl)-6-chloro-5-methyl-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylateHCID 574432723-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol

생성물 3

HCID 7095BiphenylHCID 24805585tert-Butyl (R)-3-(2-acetamidopropan-2-yl)-6-chloro-5-methyl-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylateHCID 178474761HCID 178474761, 화합물

시약·촉매·용매 5

HCID 178454896HCID 178454896, 화합물촉매HCID 679Dimethyl Sulfoxide용매3회HCID 962Water용매HCID 64052-Methyl-2-butanol용매HCID 3856267tert-Butylimino-tri(pyrrolidino)phosphorane기타

후처리

  1. additionAfter 22 hours the crude reactions were diluted with 3 x 1 uL 0.5 M AcOH in DMSO (containing PhPh as an internal standard). The reactions were mixed after each dispense operation.
  2. aliquotMosquito(R) was used to transfer 1 uL of each quenched reaction from the 1,536-well reaction plate to 384-well analytical plates containing 60 uL DMSO for analysis.

출처 및 근거

ORD 기록
ord-8adc379688e642bd963856c0ee79961b
출처 데이터셋
Cernak miniaturized Suzuki Cross-Coupling 12x10 Informer Library
원본 링크
출처 보기

반응 노트

불러오는 중…