Diethyl Oxalate → 6-Trifluoromethyloxindole

HRID 1057428

반응식

HRID 1057428 반응식
[H-].[Na+].C(OC(=O)C([O:9][CH2:10][CH3:11])=O)C.[N+:13]([C:16]1[CH:21]=[C:20]([C:22]([F:25])([F:24])[F:23])[CH:19]=[CH:18][C:17]=1C)([O-])=O.[Cl-].[NH4+]>CCCCCC.C(OCC)(=O)C.CS(C)=O>[F:23][C:22]([F:24])([F:25])[C:20]1[CH:21]=[C:16]2[C:17]([CH2:11][C:10](=[O:9])[NH:13]2)=[CH:18][CH:19]=1

참가 물질

8

반응물 4

HCID 7268Diethyl OxalateHCID 24758Sodium hydrideHCID 25517Ammonium ChlorideHCID 14728854-Methyl-3-nitrobenzotrifluoride

생성물 1

HCID 6084876-Trifluoromethyloxindole

시약·촉매·용매 3

HCID 679Dimethyl Sulfoxide용매HCID 8058Hexane용매HCID 8857Ethyl Acetate용매

반응 조건

온도
100 °C

실험 절차

Dimethylsulfoxide (330 mL) was added to 7.9 g of sodium hydride followed by, dropwise, 43.6 g of diethyloxalate. The mixture was heated to 100° C. for 1 hour and cooled to room temperature. 2-Nitro-4-trifluromethyltoluene (31.3 g) was added, the reaction stirred for 30 minutes at room temperature and then heated to 100° C. for 1 hour. The reaction was cooled and poured into a mixture of saturated aqueous ammonium chloride, ethyl acetate and hexane. The organic layer was washed with saturated ammonium chloride, water and brine, dried, and concentrated to give dimethyl

후처리

  1. temperaturecooled to room temperature
  2. temperatureheated to 100° C. for 1 hour
  3. temperatureThe reaction was cooled
  4. washThe organic layer was washed with saturated ammonium chloride, water and brine
  5. customdried
  6. concentrationconcentrated
  7. customto give dimethyl

출처 및 근거

ORD 기록
ord-7cf27e07f26d4d12827b8af62e66dd4a
출처 데이터셋
uspto-grants-2003_02
특허 번호
US06514981B1

연결된 노트

불러오는 중…