Hydrochloric Acid → N-Methoxy-N-methyl-3-(2-ethylbutyl)cyclobutanecarboxamide

HRID 1912091노트

반응식

HRID 1912091 반응식
[CH2:1]([CH:3]([CH2:12][CH3:13])[CH2:4][CH:5]1[CH2:8][CH:7]([C:9](O)=[O:10])[CH2:6]1)[CH3:2].Cl.[CH3:15][NH:16][O:17][CH3:18].C(N(CC)C(C)C)(C)C.CCN=C=NCCCN(C)C.Cl.Cl>CN(C)C1C=CN=CC=1.C(Cl)(Cl)Cl>[CH3:18][O:17][N:16]([CH3:15])[C:9]([CH:7]1[CH2:8][CH:5]([CH2:4][CH:3]([CH2:12][CH3:13])[CH2:1][CH3:2])[CH2:6]1)=[O:10]

참가 물질

8

반응물 5

HCID 313Hydrochloric AcidHCID 81138Methanamine, N-methoxy-, hydrochloride (1:1)HCID 81531DiisopropylethylamineHCID 27239391,3-Propanediamine, N'-(ethylcarbonimidoyl)-N,N-dimethyl-, monohydrochlorideHCID 866750493-(2-Ethylbutyl)cyclobutanecarboxylic acid

생성물 1

HCID 86675050N-Methoxy-N-methyl-3-(2-ethylbutyl)cyclobutanecarboxamide수율 107%

시약·촉매·용매 2

HCID 142844-(Dimethylamino)pyridine촉매HCID 6212Chloroform용매

실험 절차

3-(2-Ethylbutyl)cyclobutanecarboxylic acid (10.0 g) and chloroform (100 mL) were mixed. To the mixture were added N,O-dimethylhydroxylamine hydrochloride (6.36 g), N,N-diisopropylethylamine (11.3 mL), WSC.HCl (12.5 g) and 4-dimethylaminopyridine (7.96 g) at ice temperature. The mixture was stirred at RT overnight. After an addition of 6 N hydrochloric acid (40 mL) at ice temperature, the aqueous layer was removed. The organic layer was washed with 1 N hydrochloric acid (50 mL), water (50 mL), saturated aqueous sodium bicarbonate (50 mL) and brine (50 mL), then dried over sodium sulfate. The sodium sulfate was filtered off and the filtrate was concentrated in vacuo to give the title compound (13.2 g) as a crude product.

후처리

  1. customthe aqueous layer was removed
  2. washThe organic layer was washed with 1 N hydrochloric acid (50 mL), water (50 mL), saturated aqueous sodium bicarbonate (50 mL) and brine (50 mL)
  3. dry with materialdried over sodium sulfate
  4. filtrationThe sodium sulfate was filtered off
  5. concentrationthe filtrate was concentrated in vacuo

출처 및 근거

ORD 기록
ord-06a73f76efc64c5897f8c35ca8c88d11
출처 데이터셋
uspto-grants-2013_12
특허 번호
US08604069B2

반응 노트

불러오는 중…